About (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate
(2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate (PubChem CID 159767568) has the molecular formula C27H26O11
and a molecular weight of 526.49 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate.
Molecular Properties
| Compound Name | (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate |
| PubChem CID | 159767568 |
| Molecular Formula | C27H26O11 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate |
| SMILES | CCOc1ccccc1COC(=O)O.COC(=O)c1ccccc1OC(=O)Oc1ccccc1C(=O)OC |
| InChI | InChI=1S/C17H14O7.C10H12O4/c1-21-15(18)11-7-3-5-9-13(11)23-17(20)24-14-10-6-4-8-12(14)16(19)22-2;1-2-13-9-6-4-3-5-8(9)7-14-10(11)12/h3-10H,1-2H3;3-6H,2,7H2,1H3,(H,11,12) |
| InChIKey | NFRVCXPHVFPDDD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate?
The IUPAC name of (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate (CID 159767568) is (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate.
What is the SMILES notation for (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate?
The canonical SMILES for (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate is CCOc1ccccc1COC(=O)O.COC(=O)c1ccccc1OC(=O)Oc1ccccc1C(=O)OC.
What is the InChIKey of (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate?
The InChIKey is NFRVCXPHVFPDDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O7.C10H12O4/c1-21-15(18)11-7-3-5-9-13(11)23-17(20)24-14-10-6-4-8-12(14)16(19)22-2;1-2-13-9-6-4-3-5-8(9)7-14-10(11)12/h3-10H,1-2H3;3-6H,2,7H2,1H3,(H,11,12).
What are the key properties of (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate?
(2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate has a molecular weight of 526.49 g/mol, XLogP of 5.12, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxyphenyl)methyl hydrogen carbonate;methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate is sourced from PubChem (CID 159767568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).