C23H24N2O7 — CID 159774287
1-[(2S)-2-amino-3-carboxy-4-phenylbutanoyl]-2-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylic acid (PubChem CID 159774287) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is 1-[(2S)-2-amino-3-carboxy-4-phenylbutanoyl]-2-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(2S)-2-amino-3-carboxy-4-phenylbutanoyl]-2-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 159774287 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[(2S)-2-amino-3-carboxy-4-phenylbutanoyl]-2-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylic acid |
| SMILES | N[C@H](C(=O)C1(C(=O)O)CC1NC(=O)OCc1ccccc1)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H24N2O7/c24-18(16(20(27)28)11-14-7-3-1-4-8-14)19(26)23(21(29)30)12-17(23)25-22(31)32-13-15-9-5-2-6-10-15/h1-10,16-18H,11-13,24H2,(H,25,31)(H,27,28)(H,29,30)/t16?,17?,18-,23?/m0/s1 |
| InChIKey | NGNJUCRGLWAOSY-RNBBLLSTSA-N |
| XLogP | 1.60 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|