C19H19NO5 — CID 173400610
(3S)-2-benzyl-3-[deuterio(phenylmethoxycarbonyl)amino]-4-oxobutanoic acid (PubChem CID 173400610) has the molecular formula C19H19NO5 and a molecular weight of 342.37 g/mol. Its IUPAC name is (3S)-2-benzyl-3-[deuterio(phenylmethoxycarbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (3S)-2-benzyl-3-[deuterio(phenylmethoxycarbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 173400610 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (3S)-2-benzyl-3-[deuterio(phenylmethoxycarbonyl)amino]-4-oxobutanoic acid |
| SMILES | [2H]N(C(=O)OCc1ccccc1)[C@H](C=O)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H19NO5/c21-12-17(16(18(22)23)11-14-7-3-1-4-8-14)20-19(24)25-13-15-9-5-2-6-10-15/h1-10,12,16-17H,11,13H2,(H,20,24)(H,22,23)/t16?,17-/m1/s1/i/hD |
| InChIKey | RXFFOYVVKIOXDO-WJJSNQJOSA-N |
| XLogP | 2.42 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|