C21H46O — CID 159778218
2,5-ditert-butyl-2,3,3,4,4,5-hexamethyloxolane;ethane;methane (PubChem CID 159778218) has the molecular formula C21H46O and a molecular weight of 314.60 g/mol. Its IUPAC name is 2,5-ditert-butyl-2,3,3,4,4,5-hexamethyloxolane;ethane;methane.
| Compound Name | 2,5-ditert-butyl-2,3,3,4,4,5-hexamethyloxolane;ethane;methane |
|---|---|
| PubChem CID | 159778218 |
| Molecular Formula | C21H46O |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 314.35 |
| IUPAC Name | 2,5-ditert-butyl-2,3,3,4,4,5-hexamethyloxolane;ethane;methane |
| SMILES | C.CC.CC(C)(C)C1(C)OC(C)(C(C)(C)C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C18H36O.C2H6.CH4/c1-13(2,3)17(11)15(7,8)16(9,10)18(12,19-17)14(4,5)6;1-2;/h1-12H3;1-2H3;1H4 |
| InChIKey | NHACYARCUKLWQN-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |