C14H24O4 — CID 101147519
4,8-ditert-butyl-4,8-dimethyl-1,2,6,7-tetraoxadispiro[2.1.25.13]octane (PubChem CID 101147519) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 4,8-ditert-butyl-4,8-dimethyl-1,2,6,7-tetraoxadispiro[2.1.25.13]octane.
| Compound Name | 4,8-ditert-butyl-4,8-dimethyl-1,2,6,7-tetraoxadispiro[2.1.25.13]octane |
|---|---|
| PubChem CID | 101147519 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4,8-ditert-butyl-4,8-dimethyl-1,2,6,7-tetraoxadispiro[2.1.25.13]octane |
| SMILES | CC(C)(C)C1(C)C2(OO2)C(C)(C(C)(C)C)C12OO2 |
| InChI | InChI=1S/C14H24O4/c1-9(2,3)11(7)13(15-16-13)12(8,10(4,5)6)14(11)17-18-14/h1-8H3 |
| InChIKey | JUTLKPCWGHNLTG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|