C13H22O4 — CID 141018993
4-tert-butyl-6,10,10-trimethyl-2,3,8,9-tetraoxatricyclo[5.2.1.01,4]decane (PubChem CID 141018993) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-tert-butyl-6,10,10-trimethyl-2,3,8,9-tetraoxatricyclo[5.2.1.01,4]decane.
| Compound Name | 4-tert-butyl-6,10,10-trimethyl-2,3,8,9-tetraoxatricyclo[5.2.1.01,4]decane |
|---|---|
| PubChem CID | 141018993 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-tert-butyl-6,10,10-trimethyl-2,3,8,9-tetraoxatricyclo[5.2.1.01,4]decane |
| SMILES | CC1CC2(C(C)(C)C)OOC23OOC1C3(C)C |
| InChI | InChI=1S/C13H22O4/c1-8-7-12(10(2,3)4)13(17-15-12)11(5,6)9(8)14-16-13/h8-9H,7H2,1-6H3 |
| InChIKey | CECDHGKKEPJFBZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|