C10H21O3Sb — CID 86101784
4,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxastibinane (PubChem CID 86101784) has the molecular formula C10H21O3Sb and a molecular weight of 311.04 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxastibinane.
| Compound Name | 4,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxastibinane |
|---|---|
| PubChem CID | 86101784 |
| Molecular Formula | C10H21O3Sb |
| Molecular Weight | 311.04 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 4,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxastibinane |
| SMILES | CC1CC(C)(C)O[Sb](OC(C)(C)C)O1 |
| InChI | InChI=1S/C6H12O2.C4H9O.Sb/c1-5(7)4-6(2,3)8;1-4(2,3)5;/h5H,4H2,1-3H3;1-3H3;/q-2;-1;+3 |
| InChIKey | BDMKTIDJDYONJW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.04 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|