C12H24O4Si — CID 13268664
2,4,4,8,10,10-hexamethyl-1,5,7,11-tetraoxa-6-silaspiro[5.5]undecane (PubChem CID 13268664) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is 2,4,4,8,10,10-hexamethyl-1,5,7,11-tetraoxa-6-silaspiro[5.5]undecane.
| Compound Name | 2,4,4,8,10,10-hexamethyl-1,5,7,11-tetraoxa-6-silaspiro[5.5]undecane |
|---|---|
| PubChem CID | 13268664 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2,4,4,8,10,10-hexamethyl-1,5,7,11-tetraoxa-6-silaspiro[5.5]undecane |
| SMILES | CC1CC(C)(C)O[Si]2(O1)OC(C)CC(C)(C)O2 |
| InChI | InChI=1S/C12H24O4Si/c1-9-7-11(3,4)15-17(13-9)14-10(2)8-12(5,6)16-17/h9-10H,7-8H2,1-6H3 |
| InChIKey | GIHDQMLZBMTGKL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|