C8H15ClO — CID 131845462
(4R,6S)-4-chloro-2,2,6-trimethyloxane (PubChem CID 131845462) has the molecular formula C8H15ClO and a molecular weight of 162.66 g/mol. Its IUPAC name is (4R,6S)-4-chloro-2,2,6-trimethyloxane.
| Compound Name | (4R,6S)-4-chloro-2,2,6-trimethyloxane |
|---|---|
| PubChem CID | 131845462 |
| Molecular Formula | C8H15ClO |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | (4R,6S)-4-chloro-2,2,6-trimethyloxane |
| SMILES | C[C@H]1C[C@@H](Cl)CC(C)(C)O1 |
| InChI | InChI=1S/C8H15ClO/c1-6-4-7(9)5-8(2,3)10-6/h6-7H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | ZUEQPJUJMAEIJZ-NKWVEPMBSA-N |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|