C7H12O4 — CID 154982898
2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid (PubChem CID 154982898) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid.
| Compound Name | 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 154982898 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid |
| SMILES | CC1(C)CC(C(=O)O)C(O)O1 |
| InChI | InChI=1S/C7H12O4/c1-7(2)3-4(5(8)9)6(10)11-7/h4,6,10H,3H2,1-2H3,(H,8,9) |
| InChIKey | NVWSKYABCWIPAU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |