2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid

C7H12O4 — CID 154982898

IUPAC2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid
SMILESCC1(C)CC(C(=O)O)C(O)O1
InChIInChI=1S/C7H12O4/c1-7(2)3-4(5(8)9)6(10)11-7/h4,6,10H,3H2,1-2H3,(H,8,9)
InChIKeyNVWSKYABCWIPAU-UHFFFAOYSA-N
MW160.17 g/mol
LogP0.20
Rot. Bonds1

About 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid

2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid (PubChem CID 154982898) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid.

Molecular Properties

Compound Name2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid
PubChem CID154982898
Molecular FormulaC7H12O4
Molecular Weight160.17 g/mol
Exact Mass160.07
IUPAC Name2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid
SMILESCC1(C)CC(C(=O)O)C(O)O1
InChIInChI=1S/C7H12O4/c1-7(2)3-4(5(8)9)6(10)11-7/h4,6,10H,3H2,1-2H3,(H,8,9)
InChIKeyNVWSKYABCWIPAU-UHFFFAOYSA-N
XLogP0.20
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 50.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid?
The IUPAC name of 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid (CID 154982898) is 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid.
What is the SMILES notation for 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid?
The canonical SMILES for 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid is CC1(C)CC(C(=O)O)C(O)O1.
What is the InChIKey of 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid?
The InChIKey is NVWSKYABCWIPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-7(2)3-4(5(8)9)6(10)11-7/h4,6,10H,3H2,1-2H3,(H,8,9).
What are the key properties of 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid?
2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid has a molecular weight of 160.17 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5,5-dimethyloxolane-3-carboxylic acid is sourced from PubChem (CID 154982898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).