C16H25NO4 — CID 102743089
6-(2,2,6,6-tetramethylmorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 102743089) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 6-(2,2,6,6-tetramethylmorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(2,2,6,6-tetramethylmorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 102743089 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 6-(2,2,6,6-tetramethylmorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1(C)CN(C(=O)C2CC=CCC2C(=O)O)CC(C)(C)O1 |
| InChI | InChI=1S/C16H25NO4/c1-15(2)9-17(10-16(3,4)21-15)13(18)11-7-5-6-8-12(11)14(19)20/h5-6,11-12H,7-10H2,1-4H3,(H,19,20) |
| InChIKey | RTCIUEXXMFTKLA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|