C14H21NO4 — CID 43592570
6-(2,2-dimethylmorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 43592570) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 6-(2,2-dimethylmorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(2,2-dimethylmorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 43592570 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 6-(2,2-dimethylmorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1(C)CN(C(=O)C2CC=CCC2C(=O)O)CCO1 |
| InChI | InChI=1S/C14H21NO4/c1-14(2)9-15(7-8-19-14)12(16)10-5-3-4-6-11(10)13(17)18/h3-4,10-11H,5-9H2,1-2H3,(H,17,18) |
| InChIKey | LAFIYNIWYLXKTN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|