C10H22NO2PSe — CID 23416270
(2S,6S)-N-tert-butyl-4,4,6-trimethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-amine (PubChem CID 23416270) has the molecular formula C10H22NO2PSe and a molecular weight of 298.23 g/mol. Its IUPAC name is (2S,6S)-N-tert-butyl-4,4,6-trimethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-amine.
| Compound Name | (2S,6S)-N-tert-butyl-4,4,6-trimethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 23416270 |
| Molecular Formula | C10H22NO2PSe |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2S,6S)-N-tert-butyl-4,4,6-trimethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-amine |
| SMILES | C[C@H]1CC(C)(C)O[P@](=[Se])(NC(C)(C)C)O1 |
| InChI | InChI=1S/C10H22NO2PSe/c1-8-7-10(5,6)13-14(15,12-8)11-9(2,3)4/h8H,7H2,1-6H3,(H,11,15)/t8-,14-/m0/s1 |
| InChIKey | NEEYANFTPQPHQC-RTHLEPHNSA-N |
| XLogP | 2.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|