About sodium;iron;3-methyldioxiran-3-olate
sodium;iron;3-methyldioxiran-3-olate (PubChem CID 174549643) has the molecular formula C2H3FeNaO3
and a molecular weight of 153.88 g/mol. Its IUPAC name is sodium;iron;3-methyldioxiran-3-olate.
Molecular Properties
| Compound Name | sodium;iron;3-methyldioxiran-3-olate |
| PubChem CID | 174549643 |
| Molecular Formula | C2H3FeNaO3 |
| Molecular Weight | 153.88 g/mol |
| Exact Mass | 153.93 |
| IUPAC Name | sodium;iron;3-methyldioxiran-3-olate |
| SMILES | CC1([O-])OO1.[Fe].[Na+] |
| InChI | InChI=1S/C2H3O3.Fe.Na/c1-2(3)4-5-2;;/h1H3;;/q-1;;+1 |
| InChIKey | AFILUFHLTDBSLU-UHFFFAOYSA-N |
| XLogP | -4.02 |
| TPSA | 48.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.88 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze sodium;iron;3-methyldioxiran-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;iron;3-methyldioxiran-3-olate?
The IUPAC name of sodium;iron;3-methyldioxiran-3-olate (CID 174549643) is sodium;iron;3-methyldioxiran-3-olate.
What is the SMILES notation for sodium;iron;3-methyldioxiran-3-olate?
The canonical SMILES for sodium;iron;3-methyldioxiran-3-olate is CC1([O-])OO1.[Fe].[Na+].
What is the InChIKey of sodium;iron;3-methyldioxiran-3-olate?
The InChIKey is AFILUFHLTDBSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3O3.Fe.Na/c1-2(3)4-5-2;;/h1H3;;/q-1;;+1.
What are the key properties of sodium;iron;3-methyldioxiran-3-olate?
sodium;iron;3-methyldioxiran-3-olate has a molecular weight of 153.88 g/mol, XLogP of -4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;iron;3-methyldioxiran-3-olate is sourced from PubChem (CID 174549643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).