C15H30O5 — CID 160795972
2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9-pentaoxecane (PubChem CID 160795972) has the molecular formula C15H30O5 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9-pentaoxecane.
| Compound Name | 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9-pentaoxecane |
|---|---|
| PubChem CID | 160795972 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9-pentaoxecane |
| SMILES | CC1(C)OC(C)(C)OC(C)(C)OC(C)(C)OC(C)(C)O1 |
| InChI | InChI=1S/C15H30O5/c1-11(2)16-12(3,4)18-14(7,8)20-15(9,10)19-13(5,6)17-11/h1-10H3 |
| InChIKey | SCLJPEGOJWREFV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |