C4H9NO2 — CID 159725681
5,5-dimethyl-1,4,2-dioxazolidine (PubChem CID 159725681) has the molecular formula C4H9NO2 and a molecular weight of 103.12 g/mol. Its IUPAC name is 5,5-dimethyl-1,4,2-dioxazolidine.
| Compound Name | 5,5-dimethyl-1,4,2-dioxazolidine |
|---|---|
| PubChem CID | 159725681 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | 5,5-dimethyl-1,4,2-dioxazolidine |
| SMILES | CC1(C)OCNO1 |
| InChI | InChI=1S/C4H9NO2/c1-4(2)6-3-5-7-4/h5H,3H2,1-2H3 |
| InChIKey | NAPGGZGBXSASNH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |