C10H17NO3 — CID 163624931
(1R,2R,6R,8S,9R)-4,4,9-trimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane (PubChem CID 163624931) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (1R,2R,6R,8S,9R)-4,4,9-trimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane.
| Compound Name | (1R,2R,6R,8S,9R)-4,4,9-trimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane |
|---|---|
| PubChem CID | 163624931 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (1R,2R,6R,8S,9R)-4,4,9-trimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane |
| SMILES | C[C@@H]1CN[C@@H]2[C@H]1O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H17NO3/c1-5-4-11-6-7(5)12-9-8(6)13-10(2,3)14-9/h5-9,11H,4H2,1-3H3/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | HRFJZPQSNYNMKZ-SYHAXYEDSA-N |
| XLogP | 0.47 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |