C12H18O2 — CID 98515393
(2R,4R,6R,8R)-1,2,4,5,6,8-hexamethyl-3,7-dioxatetracyclo[3.3.0.02,4.06,8]octane (PubChem CID 98515393) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (2R,4R,6R,8R)-1,2,4,5,6,8-hexamethyl-3,7-dioxatetracyclo[3.3.0.02,4.06,8]octane.
| Compound Name | (2R,4R,6R,8R)-1,2,4,5,6,8-hexamethyl-3,7-dioxatetracyclo[3.3.0.02,4.06,8]octane |
|---|---|
| PubChem CID | 98515393 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (2R,4R,6R,8R)-1,2,4,5,6,8-hexamethyl-3,7-dioxatetracyclo[3.3.0.02,4.06,8]octane |
| SMILES | CC12C(C)([C@@]3(C)O[C@]13C)[C@@]1(C)O[C@]21C |
| InChI | InChI=1S/C12H18O2/c1-7-8(2,11(5)9(7,3)13-11)12(6)10(7,4)14-12/h1-6H3/t7?,8?,9-,10-,11-,12-/m1/s1 |
| InChIKey | IAICHWCBJHUEAN-IVWMKOAXSA-N |
| XLogP | 2.12 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|