C20H40O — CID 121286721
4-tert-butyl-1,2,2,3,3,4,5,5,6,6-decamethylcyclohexan-1-ol (PubChem CID 121286721) has the molecular formula C20H40O and a molecular weight of 296.54 g/mol. Its IUPAC name is 4-tert-butyl-1,2,2,3,3,4,5,5,6,6-decamethylcyclohexan-1-ol.
| Compound Name | 4-tert-butyl-1,2,2,3,3,4,5,5,6,6-decamethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 121286721 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 4-tert-butyl-1,2,2,3,3,4,5,5,6,6-decamethylcyclohexan-1-ol |
| SMILES | CC(C)(C)C1(C)C(C)(C)C(C)(C)C(C)(O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C20H40O/c1-14(2,3)19(12)15(4,5)17(8,9)20(13,21)18(10,11)16(19,6)7/h21H,1-13H3 |
| InChIKey | XKEDGPUSIPLWST-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |