C20H31NO — CID 159779840
N-(1-cyclohexa-1,5-dien-1-ylethoxy)-N,2-dimethyl-1-phenylpropan-1-amine;methane (PubChem CID 159779840) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is N-(1-cyclohexa-1,5-dien-1-ylethoxy)-N,2-dimethyl-1-phenylpropan-1-amine;methane.
| Compound Name | N-(1-cyclohexa-1,5-dien-1-ylethoxy)-N,2-dimethyl-1-phenylpropan-1-amine;methane |
|---|---|
| PubChem CID | 159779840 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N-(1-cyclohexa-1,5-dien-1-ylethoxy)-N,2-dimethyl-1-phenylpropan-1-amine;methane |
| SMILES | C.CC(ON(C)C(c1ccccc1)C(C)C)C1=CCCC=C1 |
| InChI | InChI=1S/C19H27NO.CH4/c1-15(2)19(18-13-9-6-10-14-18)20(4)21-16(3)17-11-7-5-8-12-17;/h6-7,9-16,19H,5,8H2,1-4H3;1H4 |
| InChIKey | NHFFOGPINUAHHF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|