C17H17BCl2O4 — CID 159782120
[4-(2,6-dichlorophenyl)-1-(2-hydroxy-3-methylphenyl)-4-oxobutan-2-yl]boronic acid (PubChem CID 159782120) has the molecular formula C17H17BCl2O4 and a molecular weight of 367.04 g/mol. Its IUPAC name is [4-(2,6-dichlorophenyl)-1-(2-hydroxy-3-methylphenyl)-4-oxobutan-2-yl]boronic acid.
| Compound Name | [4-(2,6-dichlorophenyl)-1-(2-hydroxy-3-methylphenyl)-4-oxobutan-2-yl]boronic acid |
|---|---|
| PubChem CID | 159782120 |
| Molecular Formula | C17H17BCl2O4 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [4-(2,6-dichlorophenyl)-1-(2-hydroxy-3-methylphenyl)-4-oxobutan-2-yl]boronic acid |
| SMILES | Cc1cccc(CC(CC(=O)c2c(Cl)cccc2Cl)B(O)O)c1O |
| InChI | InChI=1S/C17H17BCl2O4/c1-10-4-2-5-11(17(10)22)8-12(18(23)24)9-15(21)16-13(19)6-3-7-14(16)20/h2-7,12,22-24H,8-9H2,1H3 |
| InChIKey | ZSQUYRZBQMLARR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|