C18H21BO6 — CID 157338397
[5-(2,5-dihydroxyphenyl)-1-(2-hydroxy-3-methylphenyl)-4-oxopentan-2-yl]boronic acid (PubChem CID 157338397) has the molecular formula C18H21BO6 and a molecular weight of 344.17 g/mol. Its IUPAC name is [5-(2,5-dihydroxyphenyl)-1-(2-hydroxy-3-methylphenyl)-4-oxopentan-2-yl]boronic acid.
| Compound Name | [5-(2,5-dihydroxyphenyl)-1-(2-hydroxy-3-methylphenyl)-4-oxopentan-2-yl]boronic acid |
|---|---|
| PubChem CID | 157338397 |
| Molecular Formula | C18H21BO6 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [5-(2,5-dihydroxyphenyl)-1-(2-hydroxy-3-methylphenyl)-4-oxopentan-2-yl]boronic acid |
| SMILES | Cc1cccc(CC(CC(=O)Cc2cc(O)ccc2O)B(O)O)c1O |
| InChI | InChI=1S/C18H21BO6/c1-11-3-2-4-12(18(11)23)7-14(19(24)25)10-16(21)9-13-8-15(20)5-6-17(13)22/h2-6,8,14,20,22-25H,7,9-10H2,1H3 |
| InChIKey | QPGVSZPPWGRUTC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|