C21H19NO6 — CID 69250563
3-[(2,5-dihydroxyphenyl)methyl-[(2-hydroxyphenyl)methyl]amino]-2-hydroxybenzoic acid (PubChem CID 69250563) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is 3-[(2,5-dihydroxyphenyl)methyl-[(2-hydroxyphenyl)methyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 3-[(2,5-dihydroxyphenyl)methyl-[(2-hydroxyphenyl)methyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 69250563 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-[(2,5-dihydroxyphenyl)methyl-[(2-hydroxyphenyl)methyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(N(Cc2ccccc2O)Cc2cc(O)ccc2O)c1O |
| InChI | InChI=1S/C21H19NO6/c23-15-8-9-19(25)14(10-15)12-22(11-13-4-1-2-7-18(13)24)17-6-3-5-16(20(17)26)21(27)28/h1-10,23-26H,11-12H2,(H,27,28) |
| InChIKey | SBLTVRKEFWQPLX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|