C16H23F11N2O — CID 159783187
2,2,4,4,5,5,8,8,10,10,10-undecafluoro-N-(2-morpholin-4-ylethyl)decan-1-amine (PubChem CID 159783187) has the molecular formula C16H23F11N2O and a molecular weight of 468.35 g/mol. Its IUPAC name is 2,2,4,4,5,5,8,8,10,10,10-undecafluoro-N-(2-morpholin-4-ylethyl)decan-1-amine.
| Compound Name | 2,2,4,4,5,5,8,8,10,10,10-undecafluoro-N-(2-morpholin-4-ylethyl)decan-1-amine |
|---|---|
| PubChem CID | 159783187 |
| Molecular Formula | C16H23F11N2O |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2,2,4,4,5,5,8,8,10,10,10-undecafluoro-N-(2-morpholin-4-ylethyl)decan-1-amine |
| SMILES | FC(F)(F)CC(F)(F)CCC(F)(F)C(F)(F)CC(F)(F)CNCCN1CCOCC1 |
| InChI | InChI=1S/C16H23F11N2O/c17-12(18,10-16(25,26)27)1-2-14(21,22)15(23,24)9-13(19,20)11-28-3-4-29-5-7-30-8-6-29/h28H,1-11H2 |
| InChIKey | QPPHJXNDPXZFSC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|