C20H27BrO6 — CID 15978345
(1S,2S,4S,5R,6R,7S,8R,11S)-5-bromo-6,7,8-trihydroxy-1-methyl-6-propan-2-yl-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-en-15-one (PubChem CID 15978345) has the molecular formula C20H27BrO6 and a molecular weight of 443.33 g/mol. Its IUPAC name is (1S,2S,4S,5R,6R,7S,8R,11S)-5-bromo-6,7,8-trihydroxy-1-methyl-6-propan-2-yl-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-en-15-one.
| Compound Name | (1S,2S,4S,5R,6R,7S,8R,11S)-5-bromo-6,7,8-trihydroxy-1-methyl-6-propan-2-yl-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-en-15-one |
|---|---|
| PubChem CID | 15978345 |
| Molecular Formula | C20H27BrO6 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (1S,2S,4S,5R,6R,7S,8R,11S)-5-bromo-6,7,8-trihydroxy-1-methyl-6-propan-2-yl-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-en-15-one |
| SMILES | CC(C)[C@]1(O)[C@H](Br)[C@H]2O[C@@]23[C@@]2(C)CCC4=C(COC4=O)[C@@H]2CC[C@@]3(O)[C@@H]1O |
| InChI | InChI=1S/C20H27BrO6/c1-9(2)19(25)13(21)14-20(27-14)17(3)6-4-10-11(8-26-15(10)22)12(17)5-7-18(20,24)16(19)23/h9,12-14,16,23-25H,4-8H2,1-3H3/t12-,13+,14+,16-,17-,18+,19-,20+/m0/s1 |
| InChIKey | IOJRCLJILDTZGF-SNCNFJPMSA-N |
| XLogP | 1.44 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|