About 3-(2-aminoethyl)phenol;thiourea
3-(2-aminoethyl)phenol;thiourea (PubChem CID 159787139) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is 3-(2-aminoethyl)phenol;thiourea.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)phenol;thiourea |
| PubChem CID | 159787139 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-(2-aminoethyl)phenol;thiourea |
| SMILES | NC(N)=S.NCCc1cccc(O)c1 |
| InChI | InChI=1S/C8H11NO.CH4N2S/c9-5-4-7-2-1-3-8(10)6-7;2-1(3)4/h1-3,6,10H,4-5,9H2;(H4,2,3,4) |
| InChIKey | NICANHVZYQBTIV-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminoethyl)phenol;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)phenol;thiourea?
The IUPAC name of 3-(2-aminoethyl)phenol;thiourea (CID 159787139) is 3-(2-aminoethyl)phenol;thiourea.
What is the SMILES notation for 3-(2-aminoethyl)phenol;thiourea?
The canonical SMILES for 3-(2-aminoethyl)phenol;thiourea is NC(N)=S.NCCc1cccc(O)c1.
What is the InChIKey of 3-(2-aminoethyl)phenol;thiourea?
The InChIKey is NICANHVZYQBTIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.CH4N2S/c9-5-4-7-2-1-3-8(10)6-7;2-1(3)4/h1-3,6,10H,4-5,9H2;(H4,2,3,4).
What are the key properties of 3-(2-aminoethyl)phenol;thiourea?
3-(2-aminoethyl)phenol;thiourea has a molecular weight of 213.31 g/mol, XLogP of 0.08, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)phenol;thiourea is sourced from PubChem (CID 159787139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).