C18H28N2O3S2 — CID 159787810
(3aS,6aR)-N-(5-methyl-1-thiophen-2-ylhexan-3-yl)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxamide;sulfane (PubChem CID 159787810) has the molecular formula C18H28N2O3S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is (3aS,6aR)-N-(5-methyl-1-thiophen-2-ylhexan-3-yl)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxamide;sulfane.
| Compound Name | (3aS,6aR)-N-(5-methyl-1-thiophen-2-ylhexan-3-yl)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxamide;sulfane |
|---|---|
| PubChem CID | 159787810 |
| Molecular Formula | C18H28N2O3S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (3aS,6aR)-N-(5-methyl-1-thiophen-2-ylhexan-3-yl)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxamide;sulfane |
| SMILES | CC(C)CC(CCc1cccs1)NC(=O)N1CC[C@H]2OCC(=O)[C@H]21.S |
| InChI | InChI=1S/C18H26N2O3S.H2S/c1-12(2)10-13(5-6-14-4-3-9-24-14)19-18(22)20-8-7-16-17(20)15(21)11-23-16;/h3-4,9,12-13,16-17H,5-8,10-11H2,1-2H3,(H,19,22);1H2/t13?,16-,17-;/m1./s1 |
| InChIKey | NIEHUXMRMRMXAU-PUERSNBZSA-N |
| XLogP | 2.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |