C26H36F3N9O5 — CID 159790715
5-[5-[4-[2-(2-azidoethoxy)ethoxy]butoxy]-2,6-dimorpholin-4-ylpyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 159790715) has the molecular formula C26H36F3N9O5 and a molecular weight of 611.63 g/mol. Its IUPAC name is 5-[5-[4-[2-(2-azidoethoxy)ethoxy]butoxy]-2,6-dimorpholin-4-ylpyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[5-[4-[2-(2-azidoethoxy)ethoxy]butoxy]-2,6-dimorpholin-4-ylpyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 159790715 |
| Molecular Formula | C26H36F3N9O5 |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | 5-[5-[4-[2-(2-azidoethoxy)ethoxy]butoxy]-2,6-dimorpholin-4-ylpyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | [N-]=[N+]=NCCOCCOCCCCOc1c(-c2cnc(N)cc2C(F)(F)F)nc(N2CCOCC2)nc1N1CCOCC1 |
| InChI | InChI=1S/C26H36F3N9O5/c27-26(28,29)20-17-21(30)32-18-19(20)22-23(43-9-2-1-8-39-15-16-40-10-3-33-36-31)24(37-4-11-41-12-5-37)35-25(34-22)38-6-13-42-14-7-38/h17-18H,1-16H2,(H2,30,32) |
| InChIKey | IFMDTORDMLFMPD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|