C13H19ClNNaO4 — CID 159793330
sodium;2-(4-butan-2-ylpyridin-1-ium-1-yl)-3-hydroperoxy-2-methylpropanoate;chloride (PubChem CID 159793330) has the molecular formula C13H19ClNNaO4 and a molecular weight of 311.74 g/mol. Its IUPAC name is sodium;2-(4-butan-2-ylpyridin-1-ium-1-yl)-3-hydroperoxy-2-methylpropanoate;chloride.
| Compound Name | sodium;2-(4-butan-2-ylpyridin-1-ium-1-yl)-3-hydroperoxy-2-methylpropanoate;chloride |
|---|---|
| PubChem CID | 159793330 |
| Molecular Formula | C13H19ClNNaO4 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | sodium;2-(4-butan-2-ylpyridin-1-ium-1-yl)-3-hydroperoxy-2-methylpropanoate;chloride |
| SMILES | CCC(C)c1cc[n+](C(C)(COO)C(=O)[O-])cc1.[Cl-].[Na+] |
| InChI | InChI=1S/C13H19NO4.ClH.Na/c1-4-10(2)11-5-7-14(8-6-11)13(3,9-18-17)12(15)16;;/h5-8,10H,4,9H2,1-3H3,(H-,15,16,17);1H;/q;;+1/p-1 |
| InChIKey | GWDXJSGVCDETGP-UHFFFAOYSA-M |
| XLogP | -5.55 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | -5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|