C40H33F9IO+ — CID 159799175
[5-hexyl-2,3,4-tris[3-(trifluoromethyl)phenyl]phenyl]-(4-methoxyphenyl)iodanium (PubChem CID 159799175) has the molecular formula C40H33F9IO+ and a molecular weight of 827.59 g/mol. Its IUPAC name is [5-hexyl-2,3,4-tris[3-(trifluoromethyl)phenyl]phenyl]-(4-methoxyphenyl)iodanium.
| Compound Name | [5-hexyl-2,3,4-tris[3-(trifluoromethyl)phenyl]phenyl]-(4-methoxyphenyl)iodanium |
|---|---|
| PubChem CID | 159799175 |
| Molecular Formula | C40H33F9IO+ |
| Molecular Weight | 827.59 g/mol |
| Exact Mass | 827.14 |
| IUPAC Name | [5-hexyl-2,3,4-tris[3-(trifluoromethyl)phenyl]phenyl]-(4-methoxyphenyl)iodanium |
| SMILES | CCCCCCc1cc([I+]c2ccc(OC)cc2)c(-c2cccc(C(F)(F)F)c2)c(-c2cccc(C(F)(F)F)c2)c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C40H33F9IO/c1-3-4-5-6-10-28-24-34(50-32-17-19-33(51-2)20-18-32)36(26-12-8-15-30(22-26)39(44,45)46)37(27-13-9-16-31(23-27)40(47,48)49)35(28)25-11-7-14-29(21-25)38(41,42)43/h7-9,11-24H,3-6,10H2,1-2H3/q+1 |
| InChIKey | JFNFKFUUIWQTPH-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.59 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|