C23H32Cl2N2O — CID 159801228
5-tert-butyl-3-chloro-2-cyclopropylpyridine;5-tert-butyl-3-chloro-2-ethoxypyridine (PubChem CID 159801228) has the molecular formula C23H32Cl2N2O and a molecular weight of 423.43 g/mol. Its IUPAC name is 5-tert-butyl-3-chloro-2-cyclopropylpyridine;5-tert-butyl-3-chloro-2-ethoxypyridine.
| Compound Name | 5-tert-butyl-3-chloro-2-cyclopropylpyridine;5-tert-butyl-3-chloro-2-ethoxypyridine |
|---|---|
| PubChem CID | 159801228 |
| Molecular Formula | C23H32Cl2N2O |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 5-tert-butyl-3-chloro-2-cyclopropylpyridine;5-tert-butyl-3-chloro-2-ethoxypyridine |
| SMILES | CC(C)(C)c1cnc(C2CC2)c(Cl)c1.CCOc1ncc(C(C)(C)C)cc1Cl |
| InChI | InChI=1S/C12H16ClN.C11H16ClNO/c1-12(2,3)9-6-10(13)11(14-7-9)8-4-5-8;1-5-14-10-9(12)6-8(7-13-10)11(2,3)4/h6-8H,4-5H2,1-3H3;6-7H,5H2,1-4H3 |
| InChIKey | NJUUJGYNQAIQAF-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |