C26H12N4 — CID 159802251
6-isocyano-4,10-dimethylperylene-1,3,9-tricarbonitrile (PubChem CID 159802251) has the molecular formula C26H12N4 and a molecular weight of 380.41 g/mol. Its IUPAC name is 6-isocyano-4,10-dimethylperylene-1,3,9-tricarbonitrile.
| Compound Name | 6-isocyano-4,10-dimethylperylene-1,3,9-tricarbonitrile |
|---|---|
| PubChem CID | 159802251 |
| Molecular Formula | C26H12N4 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 6-isocyano-4,10-dimethylperylene-1,3,9-tricarbonitrile |
| SMILES | [C-]#[N+]c1cc(C)c2c(C#N)cc(C#N)c3c4ccc(C)c5c(C#N)ccc(c1c23)c54 |
| InChI | InChI=1S/C26H12N4/c1-13-4-6-18-23-17(12-29)9-16(11-28)22-14(2)8-20(30-3)25(26(22)23)19-7-5-15(10-27)21(13)24(18)19/h4-9H,1-2H3 |
| InChIKey | FREFOTOQVVNIAB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 75.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|