C28H37N3O5S — CID 15980653
8-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-3-(4-methylsulfonylphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 15980653) has the molecular formula C28H37N3O5S and a molecular weight of 527.69 g/mol. Its IUPAC name is 8-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-3-(4-methylsulfonylphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-3-(4-methylsulfonylphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 15980653 |
| Molecular Formula | C28H37N3O5S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 8-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-3-(4-methylsulfonylphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc(N2CCC3(CC2)CN(c2ccc(S(C)(=O)=O)cc2)C(=O)O3)cc1 |
| InChI | InChI=1S/C28H37N3O5S/c1-22-5-3-16-29(22)17-4-20-35-25-10-6-23(7-11-25)30-18-14-28(15-19-30)21-31(27(32)36-28)24-8-12-26(13-9-24)37(2,33)34/h6-13,22H,3-5,14-21H2,1-2H3/t22-/m1/s1 |
| InChIKey | IETCTMHLYGNBNM-JOCHJYFZSA-N |
| XLogP | 4.34 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|