C26H33FN4O3 — CID 15979790
3-(5-fluoro-2-pyridinyl)-8-[4-(3-piperidin-1-ylpropoxy)phenyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 15979790) has the molecular formula C26H33FN4O3 and a molecular weight of 468.57 g/mol. Its IUPAC name is 3-(5-fluoro-2-pyridinyl)-8-[4-(3-piperidin-1-ylpropoxy)phenyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 3-(5-fluoro-2-pyridinyl)-8-[4-(3-piperidin-1-ylpropoxy)phenyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 15979790 |
| Molecular Formula | C26H33FN4O3 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3-(5-fluoro-2-pyridinyl)-8-[4-(3-piperidin-1-ylpropoxy)phenyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1OC2(CCN(c3ccc(OCCCN4CCCCC4)cc3)CC2)CN1c1ccc(F)cn1 |
| InChI | InChI=1S/C26H33FN4O3/c27-21-5-10-24(28-19-21)31-20-26(34-25(31)32)11-16-30(17-12-26)22-6-8-23(9-7-22)33-18-4-15-29-13-2-1-3-14-29/h5-10,19H,1-4,11-18,20H2 |
| InChIKey | QWHXPONPXVVATI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|