C27H35FN4O3 — CID 66783828
4-(2-fluoro-4-pyridinyl)-9-[4-(3-piperidin-1-ylpropoxy)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 66783828) has the molecular formula C27H35FN4O3 and a molecular weight of 482.60 g/mol. Its IUPAC name is 4-(2-fluoro-4-pyridinyl)-9-[4-(3-piperidin-1-ylpropoxy)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 4-(2-fluoro-4-pyridinyl)-9-[4-(3-piperidin-1-ylpropoxy)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 66783828 |
| Molecular Formula | C27H35FN4O3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 4-(2-fluoro-4-pyridinyl)-9-[4-(3-piperidin-1-ylpropoxy)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1COC2(CCN(c3ccc(OCCCN4CCCCC4)cc3)CC2)CN1c1ccnc(F)c1 |
| InChI | InChI=1S/C27H35FN4O3/c28-25-19-23(9-12-29-25)32-21-27(35-20-26(32)33)10-16-31(17-11-27)22-5-7-24(8-6-22)34-18-4-15-30-13-2-1-3-14-30/h5-9,12,19H,1-4,10-11,13-18,20-21H2 |
| InChIKey | MGGKRNOKDMEPLX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|