C27H33F2N3O3 — CID 15980160
4-(3,4-difluorophenyl)-9-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 15980160) has the molecular formula C27H33F2N3O3 and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-9-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 4-(3,4-difluorophenyl)-9-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 15980160 |
| Molecular Formula | C27H33F2N3O3 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 4-(3,4-difluorophenyl)-9-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1COC2(CCN(c3ccc(OCCCN4CCCC4)cc3)CC2)CN1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C27H33F2N3O3/c28-24-9-6-22(18-25(24)29)32-20-27(35-19-26(32)33)10-15-31(16-11-27)21-4-7-23(8-5-21)34-17-3-14-30-12-1-2-13-30/h4-9,18H,1-3,10-17,19-20H2 |
| InChIKey | RTHRCSVDWDJUQP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|