C14H17F2NO2 — CID 39367532
1-[3-(3,4-difluorophenoxy)propyl]piperidin-4-one (PubChem CID 39367532) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is 1-[3-(3,4-difluorophenoxy)propyl]piperidin-4-one.
| Compound Name | 1-[3-(3,4-difluorophenoxy)propyl]piperidin-4-one |
|---|---|
| PubChem CID | 39367532 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-[3-(3,4-difluorophenoxy)propyl]piperidin-4-one |
| SMILES | O=C1CCN(CCCOc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C14H17F2NO2/c15-13-3-2-12(10-14(13)16)19-9-1-6-17-7-4-11(18)5-8-17/h2-3,10H,1,4-9H2 |
| InChIKey | UVOGDWPHWFZQJL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|