C33H38Cl2N4O3S — CID 15980670
N-cyclopropyl-2-[(1R,5S)-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-7-en-6-yl]-N-[(2,3-dimethylphenyl)methyl]acetamide (PubChem CID 15980670) has the molecular formula C33H38Cl2N4O3S and a molecular weight of 641.67 g/mol. Its IUPAC name is N-cyclopropyl-2-[(1R,5S)-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-7-en-6-yl]-N-[(2,3-dimethylphenyl)methyl]acetamide.
| Compound Name | N-cyclopropyl-2-[(1R,5S)-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-7-en-6-yl]-N-[(2,3-dimethylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 15980670 |
| Molecular Formula | C33H38Cl2N4O3S |
| Molecular Weight | 641.67 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | N-cyclopropyl-2-[(1R,5S)-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-7-en-6-yl]-N-[(2,3-dimethylphenyl)methyl]acetamide |
| SMILES | Cc1cc(Cl)c(OCCOc2ncc(C3=C[C@@H]4CNC[C@@H](N4)C3CC(=O)N(Cc3cccc(C)c3C)C3CC3)s2)c(Cl)c1 |
| InChI | InChI=1S/C33H38Cl2N4O3S/c1-19-11-27(34)32(28(35)12-19)41-9-10-42-33-37-17-30(43-33)26-13-23-15-36-16-29(38-23)25(26)14-31(40)39(24-7-8-24)18-22-6-4-5-20(2)21(22)3/h4-6,11-13,17,23-25,29,36,38H,7-10,14-16,18H2,1-3H3/t23-,25?,29-/m1/s1 |
| InChIKey | IDWSSKYFNZEODJ-BOWUKJPASA-N |
| XLogP | 6.36 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|