About diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde
diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde (PubChem CID 159810817) has the molecular formula C24H42O8
and a molecular weight of 458.59 g/mol. Its IUPAC name is diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde.
Molecular Properties
| Compound Name | diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde |
| PubChem CID | 159810817 |
| Molecular Formula | C24H42O8 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde |
| SMILES | C=O.C=O.CCOC(=O)CC(CCC(C)CCCCC(CC(C)=O)C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C22H38O6.2CH2O/c1-6-27-21(25)15-20(22(26)28-7-2)13-12-16(3)10-8-9-11-19(18(5)24)14-17(4)23;2*1-2/h16,19-20H,6-15H2,1-5H3;2*1H2 |
| InChIKey | NKZOEKZCKLAXPS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde?
The IUPAC name of diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde (CID 159810817) is diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde.
What is the SMILES notation for diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde?
The canonical SMILES for diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde is C=O.C=O.CCOC(=O)CC(CCC(C)CCCCC(CC(C)=O)C(C)=O)C(=O)OCC.
What is the InChIKey of diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde?
The InChIKey is NKZOEKZCKLAXPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O6.2CH2O/c1-6-27-21(25)15-20(22(26)28-7-2)13-12-16(3)10-8-9-11-19(18(5)24)14-17(4)23;2*1-2/h16,19-20H,6-15H2,1-5H3;2*1H2.
What are the key properties of diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde?
diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde has a molecular weight of 458.59 g/mol, XLogP of 3.91, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(8-acetyl-3-methyl-10-oxoundecyl)butanedioate;formaldehyde is sourced from PubChem (CID 159810817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).