C8H10N6O2 — CID 159815803
4-amino-1,3-diazabicyclo[3.1.0]hex-3-en-2-one;2-cyanoaziridine-1-carboxamide (PubChem CID 159815803) has the molecular formula C8H10N6O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is 4-amino-1,3-diazabicyclo[3.1.0]hex-3-en-2-one;2-cyanoaziridine-1-carboxamide.
| Compound Name | 4-amino-1,3-diazabicyclo[3.1.0]hex-3-en-2-one;2-cyanoaziridine-1-carboxamide |
|---|---|
| PubChem CID | 159815803 |
| Molecular Formula | C8H10N6O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-amino-1,3-diazabicyclo[3.1.0]hex-3-en-2-one;2-cyanoaziridine-1-carboxamide |
| SMILES | N#CC1CN1C(N)=O.NC1=NC(=O)N2CC12 |
| InChI | InChI=1S/2C4H5N3O/c5-3-2-1-7(2)4(8)6-3;5-1-3-2-7(3)4(6)8/h2H,1H2,(H2,5,6,8);3H,2H2,(H2,6,8) |
| InChIKey | NLPIOWXTGBBORF-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|