C15H25F2NO5S — CID 159818465
ethyl 2-[[(R)-tert-butylsulfinyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,4-difluorobut-2-enoate (PubChem CID 159818465) has the molecular formula C15H25F2NO5S and a molecular weight of 369.43 g/mol. Its IUPAC name is ethyl 2-[[(R)-tert-butylsulfinyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,4-difluorobut-2-enoate.
| Compound Name | ethyl 2-[[(R)-tert-butylsulfinyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,4-difluorobut-2-enoate |
|---|---|
| PubChem CID | 159818465 |
| Molecular Formula | C15H25F2NO5S |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl 2-[[(R)-tert-butylsulfinyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,4-difluorobut-2-enoate |
| SMILES | CCOC(=O)C(=CC(F)F)N(C(=O)OC(C)(C)C)[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C15H25F2NO5S/c1-8-22-12(19)10(9-11(16)17)18(24(21)15(5,6)7)13(20)23-14(2,3)4/h9,11H,8H2,1-7H3/t24-/m1/s1 |
| InChIKey | AHSYQOFYWZGIPY-XMMPIXPASA-N |
| XLogP | 3.40 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|