C23H24F6N6O3 — CID 15982187
7-[2-[2-(methoxymethyl)pyrrolidin-1-yl]-6-(trifluoromethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid (PubChem CID 15982187) has the molecular formula C23H24F6N6O3 and a molecular weight of 546.47 g/mol. Its IUPAC name is 7-[2-[2-(methoxymethyl)pyrrolidin-1-yl]-6-(trifluoromethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-[2-[2-(methoxymethyl)pyrrolidin-1-yl]-6-(trifluoromethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 15982187 |
| Molecular Formula | C23H24F6N6O3 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 7-[2-[2-(methoxymethyl)pyrrolidin-1-yl]-6-(trifluoromethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CNc1nc(N)nc2nc(-c3c(N4CCCC4COC)cccc3C(F)(F)F)ccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23F3N6O.C2HF3O2/c1-26-18-13-8-9-15(27-19(13)29-20(25)28-18)17-14(21(22,23)24)6-3-7-16(17)30-10-4-5-12(30)11-31-2;3-2(4,5)1(6)7/h3,6-9,12H,4-5,10-11H2,1-2H3,(H3,25,26,27,28,29);(H,6,7) |
| InChIKey | VYTCCXXHKONQLZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |