About ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde
ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde (PubChem CID 159823535) has the molecular formula C35H45NO5
and a molecular weight of 559.75 g/mol. Its IUPAC name is ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde.
Molecular Properties
| Compound Name | ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde |
| PubChem CID | 159823535 |
| Molecular Formula | C35H45NO5 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde |
| SMILES | CC.CC.CC.CC.O=Cc1ccc(Oc2ccccc2)cc1.O=[N+]([O-])/C=C/c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C14H11NO3.C13H10O2.4C2H6/c16-15(17)11-10-12-6-8-14(9-7-12)18-13-4-2-1-3-5-13;14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12;4*1-2/h1-11H;1-10H;4*1-2H3/b11-10+;;;;; |
| InChIKey | NMNQWPQRVDDMQS-RJNQGHNVSA-N |
| XLogP | 11.12 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde?
The IUPAC name of ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde (CID 159823535) is ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde.
What is the SMILES notation for ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde?
The canonical SMILES for ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde is CC.CC.CC.CC.O=Cc1ccc(Oc2ccccc2)cc1.O=[N+]([O-])/C=C/c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde?
The InChIKey is NMNQWPQRVDDMQS-RJNQGHNVSA-N. The full InChI is InChI=1S/C14H11NO3.C13H10O2.4C2H6/c16-15(17)11-10-12-6-8-14(9-7-12)18-13-4-2-1-3-5-13;14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12;4*1-2/h1-11H;1-10H;4*1-2H3/b11-10+;;;;;.
What are the key properties of ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde?
ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde has a molecular weight of 559.75 g/mol, XLogP of 11.12, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(E)-2-nitroethenyl]-4-phenoxybenzene;4-phenoxybenzaldehyde is sourced from PubChem (CID 159823535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).