C36H45BrO11 — CID 159830894
2-(bromomethyl)prop-2-enoic acid;methyl 4-[5-(4-methylidene-5-oxooxolan-2-yl)pentoxy]benzoate;methyl 4-(6-oxohexoxy)benzoate (PubChem CID 159830894) has the molecular formula C36H45BrO11 and a molecular weight of 733.65 g/mol. Its IUPAC name is 2-(bromomethyl)prop-2-enoic acid;methyl 4-[5-(4-methylidene-5-oxooxolan-2-yl)pentoxy]benzoate;methyl 4-(6-oxohexoxy)benzoate.
| Compound Name | 2-(bromomethyl)prop-2-enoic acid;methyl 4-[5-(4-methylidene-5-oxooxolan-2-yl)pentoxy]benzoate;methyl 4-(6-oxohexoxy)benzoate |
|---|---|
| PubChem CID | 159830894 |
| Molecular Formula | C36H45BrO11 |
| Molecular Weight | 733.65 g/mol |
| Exact Mass | 732.21 |
| IUPAC Name | 2-(bromomethyl)prop-2-enoic acid;methyl 4-[5-(4-methylidene-5-oxooxolan-2-yl)pentoxy]benzoate;methyl 4-(6-oxohexoxy)benzoate |
| SMILES | C=C(CBr)C(=O)O.C=C1CC(CCCCCOc2ccc(C(=O)OC)cc2)OC1=O.COC(=O)c1ccc(OCCCCCC=O)cc1 |
| InChI | InChI=1S/C18H22O5.C14H18O4.C4H5BrO2/c1-13-12-16(23-17(13)19)6-4-3-5-11-22-15-9-7-14(8-10-15)18(20)21-2;1-17-14(16)12-6-8-13(9-7-12)18-11-5-3-2-4-10-15;1-3(2-5)4(6)7/h7-10,16H,1,3-6,11-12H2,2H3;6-10H,2-5,11H2,1H3;1-2H2,(H,6,7) |
| InChIKey | NNLIQJITMGDTCV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|