C22H35NO8 — CID 159833789
tert-butyl N-(4-hydroxycyclopent-2-en-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;(4-hydroxycyclopent-2-en-1-yl) acetate (PubChem CID 159833789) has the molecular formula C22H35NO8 and a molecular weight of 441.52 g/mol. Its IUPAC name is tert-butyl N-(4-hydroxycyclopent-2-en-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;(4-hydroxycyclopent-2-en-1-yl) acetate.
| Compound Name | tert-butyl N-(4-hydroxycyclopent-2-en-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;(4-hydroxycyclopent-2-en-1-yl) acetate |
|---|---|
| PubChem CID | 159833789 |
| Molecular Formula | C22H35NO8 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | tert-butyl N-(4-hydroxycyclopent-2-en-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;(4-hydroxycyclopent-2-en-1-yl) acetate |
| SMILES | CC(=O)OC1C=CC(O)C1.CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1C=CC(O)C1 |
| InChI | InChI=1S/C15H25NO5.C7H10O3/c1-14(2,3)20-12(18)16(10-7-8-11(17)9-10)13(19)21-15(4,5)6;1-5(8)10-7-3-2-6(9)4-7/h7-8,10-11,17H,9H2,1-6H3;2-3,6-7,9H,4H2,1H3 |
| InChIKey | NNUHALUQJUVACT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|