C13H21NO5 — CID 11311772
[(1R,4S)-4-[ethoxycarbonyl(3-hydroxypropyl)amino]cyclopent-2-en-1-yl] acetate (PubChem CID 11311772) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is [(1R,4S)-4-[ethoxycarbonyl(3-hydroxypropyl)amino]cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,4S)-4-[ethoxycarbonyl(3-hydroxypropyl)amino]cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11311772 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | [(1R,4S)-4-[ethoxycarbonyl(3-hydroxypropyl)amino]cyclopent-2-en-1-yl] acetate |
| SMILES | CCOC(=O)N(CCCO)[C@@H]1C=C[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C13H21NO5/c1-3-18-13(17)14(7-4-8-15)11-5-6-12(9-11)19-10(2)16/h5-6,11-12,15H,3-4,7-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | DZOMOUZNKWVNPE-NEPJUHHUSA-N |
| XLogP | 1.09 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|