C50H66O8 — CID 159834876
(1,5-dimethyl-10-oxo-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) (E)-3-phenylbut-2-enoate;(10-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) (E)-3-phenylbut-2-enoate (PubChem CID 159834876) has the molecular formula C50H66O8 and a molecular weight of 795.07 g/mol. Its IUPAC name is (1,5-dimethyl-10-oxo-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) (E)-3-phenylbut-2-enoate;(10-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) (E)-3-phenylbut-2-enoate.
| Compound Name | (1,5-dimethyl-10-oxo-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) (E)-3-phenylbut-2-enoate;(10-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) (E)-3-phenylbut-2-enoate |
|---|---|
| PubChem CID | 159834876 |
| Molecular Formula | C50H66O8 |
| Molecular Weight | 795.07 g/mol |
| Exact Mass | 794.48 |
| IUPAC Name | (1,5-dimethyl-10-oxo-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) (E)-3-phenylbut-2-enoate;(10-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) (E)-3-phenylbut-2-enoate |
| SMILES | C/C(=C\C(=O)OC1C2C(C)CCC2C2(C)OC1(C(C)C)CC2=O)c1ccccc1.C/C(=C\C(=O)OC1C2C(C)CCC2C2(C)OC1(C(C)C)CC2O)c1ccccc1 |
| InChI | InChI=1S/C25H34O4.C25H32O4/c2*1-15(2)25-14-20(26)24(5,29-25)19-12-11-16(3)22(19)23(25)28-21(27)13-17(4)18-9-7-6-8-10-18/h6-10,13,15-16,19-20,22-23,26H,11-12,14H2,1-5H3;6-10,13,15-16,19,22-23H,11-12,14H2,1-5H3/b2*17-13+ |
| InChIKey | NNXXHAPDUPZZGK-XATDXQFTSA-N |
| XLogP | 9.43 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.07 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|