C29H38O6 — CID 137401720
[8-cyclohexyl-10-(2-hydroxyacetyl)oxy-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl] (E)-3-phenylprop-2-enoate (PubChem CID 137401720) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is [8-cyclohexyl-10-(2-hydroxyacetyl)oxy-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [8-cyclohexyl-10-(2-hydroxyacetyl)oxy-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 137401720 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | [8-cyclohexyl-10-(2-hydroxyacetyl)oxy-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC1CCC2C1C(OC(=O)/C=C/c1ccccc1)C1(C3CCCCC3)CC(OC(=O)CO)C2(C)O1 |
| InChI | InChI=1S/C29H38O6/c1-19-13-15-22-26(19)27(34-24(31)16-14-20-9-5-3-6-10-20)29(21-11-7-4-8-12-21)17-23(28(22,2)35-29)33-25(32)18-30/h3,5-6,9-10,14,16,19,21-23,26-27,30H,4,7-8,11-13,15,17-18H2,1-2H3/b16-14+ |
| InChIKey | JXFQQIYBAMHDFG-JQIJEIRASA-N |
| XLogP | 4.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|