C25H22Cl2N2O4 — CID 15984182
(2S)-2-[(3,4-dichlorophenyl)methylamino]-5-oxo-5-[(4-phenylbenzoyl)amino]pentanoic acid (PubChem CID 15984182) has the molecular formula C25H22Cl2N2O4 and a molecular weight of 485.37 g/mol. Its IUPAC name is (2S)-2-[(3,4-dichlorophenyl)methylamino]-5-oxo-5-[(4-phenylbenzoyl)amino]pentanoic acid.
| Compound Name | (2S)-2-[(3,4-dichlorophenyl)methylamino]-5-oxo-5-[(4-phenylbenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 15984182 |
| Molecular Formula | C25H22Cl2N2O4 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | (2S)-2-[(3,4-dichlorophenyl)methylamino]-5-oxo-5-[(4-phenylbenzoyl)amino]pentanoic acid |
| SMILES | O=C(CC[C@H](NCc1ccc(Cl)c(Cl)c1)C(=O)O)NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22Cl2N2O4/c26-20-11-6-16(14-21(20)27)15-28-22(25(32)33)12-13-23(30)29-24(31)19-9-7-18(8-10-19)17-4-2-1-3-5-17/h1-11,14,22,28H,12-13,15H2,(H,32,33)(H,29,30,31)/t22-/m0/s1 |
| InChIKey | QROIDSHQYBNJRI-QFIPXVFZSA-N |
| XLogP | 4.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |