C24H24Cl2O6 — CID 155706395
5-(3,4-dichlorophenyl)pentane-1,1,2,3-tetrol;4-phenylbenzoic acid (PubChem CID 155706395) has the molecular formula C24H24Cl2O6 and a molecular weight of 479.36 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)pentane-1,1,2,3-tetrol;4-phenylbenzoic acid.
| Compound Name | 5-(3,4-dichlorophenyl)pentane-1,1,2,3-tetrol;4-phenylbenzoic acid |
|---|---|
| PubChem CID | 155706395 |
| Molecular Formula | C24H24Cl2O6 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 5-(3,4-dichlorophenyl)pentane-1,1,2,3-tetrol;4-phenylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1.OC(O)C(O)C(O)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10O2.C11H14Cl2O4/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;12-7-3-1-6(5-8(7)13)2-4-9(14)10(15)11(16)17/h1-9H,(H,14,15);1,3,5,9-11,14-17H,2,4H2 |
| InChIKey | WAEUWQLQLFMQPW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|